4-[1-(4-methoxyphenyl)ethyl]-2,6-ditert-butyl-phenol structure
|
Common Name | 4-[1-(4-methoxyphenyl)ethyl]-2,6-ditert-butyl-phenol | ||
|---|---|---|---|---|
| CAS Number | 71712-06-6 | Molecular Weight | 340.49900 | |
| Density | 0.995g/cm3 | Boiling Point | 398.7ºC at 760 mmHg | |
| Molecular Formula | C23H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.1ºC | |
| Name | 2,6-ditert-butyl-4-[1-(4-methoxyphenyl)ethyl]phenol |
|---|
| Density | 0.995g/cm3 |
|---|---|
| Boiling Point | 398.7ºC at 760 mmHg |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.49900 |
| Flash Point | 107.1ºC |
| Exact Mass | 340.24000 |
| PSA | 29.46000 |
| LogP | 6.14760 |
| Index of Refraction | 1.529 |
| InChIKey | QGEDAWROPAYZFD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
|
~%
4-[1-(4-methoxy... CAS#:71712-06-6 |
| Literature: The United States of America as represented by the Secretary of Agriculture Patent: US4342777 A1, 1982 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |