1,3-Benzodioxole,5-ethoxy-6-[(4-methoxyphenyl)methyl]- structure
|
Common Name | 1,3-Benzodioxole,5-ethoxy-6-[(4-methoxyphenyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 71712-08-8 | Molecular Weight | 286.32200 | |
| Density | 1.17g/cm3 | Boiling Point | 397.5ºC at 760 mmHg | |
| Molecular Formula | C17H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134ºC | |
| Name | 5-ethoxy-6-[(4-methoxyphenyl)methyl]-1,3-benzodioxole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 397.5ºC at 760 mmHg |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.32200 |
| Flash Point | 134ºC |
| Exact Mass | 286.12100 |
| PSA | 36.92000 |
| LogP | 3.41340 |
| Index of Refraction | 1.565 |
| InChIKey | UJCODZLQXNZQPJ-UHFFFAOYSA-N |
| SMILES | CCOc1cc2c(cc1Cc1ccc(OC)cc1)OCO2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-ETHOXY-6-(4-METHOXYPHENYLMETHYL)-1,3-BENZODIOXOLE |
| 5-Ethoxy-6-(4-methoxybenzyl)-1,3-benzodioxole |