4-(2,5-dimethoxyphenyl)phenol structure
|
Common Name | 4-(2,5-dimethoxyphenyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 71715-47-4 | Molecular Weight | 230.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2,5-dimethoxyphenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14O3 |
|---|---|
| Molecular Weight | 230.25900 |
| Exact Mass | 230.09400 |
| PSA | 38.69000 |
| LogP | 3.07640 |
| InChIKey | OQFXFWJDWYSGLZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(-c2ccc(O)cc2)c1 |
|
~%
4-(2,5-dimethox... CAS#:71715-47-4 |
| Literature: Marini-Bettolo Gazzetta Chimica Italiana, 1941 , vol. 71, p. 635,640 |
|
~3%
4-(2,5-dimethox... CAS#:71715-47-4 |
| Literature: Sartori, Giovanni; Maggi, Raimondo; Bigi, Franca; Casnati, Guiseppe Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 12 p. 3059 - 3064 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4'-Hydroxy-2,5-dimethoxy-biphenyl |
| 2',5'-dimethoxybiphenyl-4-ol |