o-nitrobenzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) structure
|
Common Name | o-nitrobenzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 71720-51-9 | Molecular Weight | 316.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H20N2O7 |
|---|---|
| Molecular Weight | 316.30700 |
| Exact Mass | 316.12700 |
| PSA | 147.05000 |
| LogP | 0.08150 |
| InChIKey | GZPKSAMPTUEDKY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1[N+](=O)[O-].OCCN(CCO)CCO |
| o-Nitrobenzoic acid,compound with 2,2',2''-nitrilotriethanol (1:1) |
| EINECS 275-900-1 |