2-sec-butyl-4,6-dinitrophenol, compound with 1-aminopropan-2-ol (1:1) structure
|
Common Name | 2-sec-butyl-4,6-dinitrophenol, compound with 1-aminopropan-2-ol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 71735-19-8 | Molecular Weight | 315.32200 | |
| Density | N/A | Boiling Point | 456.8ºC at 760mmHg | |
| Molecular Formula | C13H21N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-aminopropan-2-ol,2-butan-2-yl-4,6-dinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 456.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C13H21N3O6 |
| Molecular Weight | 315.32200 |
| Exact Mass | 315.14300 |
| PSA | 158.12000 |
| LogP | 3.79470 |
| InChIKey | CLIBIKHWBFUNNU-UHFFFAOYSA-N |
| SMILES | CC(O)CN.CCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| einecs 275-931-0 |