4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with N,N-diethyl-3-phenyl-1,2,4-oxadiazole-5-ethylamine (1:1) structure
|
Common Name | 4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with N,N-diethyl-3-phenyl-1,2,4-oxadiazole-5-ethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 71750-53-3 | Molecular Weight | 633.6897 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H35N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with N,N-diethyl-3-phenyl-1,2,4-oxadiazole-5-ethylamine (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C37H35N3O7 |
|---|---|
| Molecular Weight | 633.6897 |
| InChIKey | GRSSMUQHIFFKOZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCc1nc(-c2ccccc2)no1.O=C(O)c1cc2ccccc2c(Cc2c(O)c(C(=O)O)cc3ccccc23)c1O |
| EINECS 275-980-8 |