N,N-dimethyl-8-oxo-8-phenyl-2,4,7,9-tetraza-8$l^C12H14N5OP-phosphabicyclo[4.3.0]nona-2,4,10-trien-5-amine structure
|
Common Name | N,N-dimethyl-8-oxo-8-phenyl-2,4,7,9-tetraza-8$l^C12H14N5OP-phosphabicyclo[4.3.0]nona-2,4,10-trien-5-amine | ||
|---|---|---|---|---|
| CAS Number | 7178-16-7 | Molecular Weight | 275.24600 | |
| Density | 1.39g/cm3 | Boiling Point | 455.5ºC at 760 mmHg | |
| Molecular Formula | C12H14N5OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.3ºC | |
| Name | N,N-dimethyl-2-oxo-2-phenyl-1,3-dihydro-[1,3,2]diazaphospholo[4,5-d]pyrimidin-7-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 455.5ºC at 760 mmHg |
| Molecular Formula | C12H14N5OP |
| Molecular Weight | 275.24600 |
| Flash Point | 229.3ºC |
| Exact Mass | 275.09400 |
| PSA | 79.96000 |
| LogP | 2.17460 |
| Index of Refraction | 1.653 |
| InChIKey | JJDZFOLKZOWJMF-UHFFFAOYSA-N |
| SMILES | CN(C)c1ncnc2c1NP(=O)(c1ccccc1)N2 |
|
~%
N,N-dimethyl-8-... CAS#:7178-16-7 |
| Literature: Lister,J.H.; Timmis,G.M. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 1242 - 1244 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 7-Dimethylamino-2-phenyl-1,3-diaza-1,3-dihydro-2-phospholo<4,5-d>pyrimidin-2-oxid |