6-Methyl-7-nitro-1H-indazole structure
|
Common Name | 6-Methyl-7-nitro-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 717881-06-6 | Molecular Weight | 177.160 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 379.7±22.0 °C at 760 mmHg | |
| Molecular Formula | C8H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.4±22.3 °C | |
| Name | 6-Methyl-7-nitro-1H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 379.7±22.0 °C at 760 mmHg |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.160 |
| Flash Point | 183.4±22.3 °C |
| Exact Mass | 177.053833 |
| PSA | 74.50000 |
| LogP | 1.91 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | MFJNZLMQVJRCIW-UHFFFAOYSA-N |
| SMILES | Cc1ccc2cn[nH]c2c1[N+](=O)[O-] |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole,6-methyl-7-nitro |
| HMS2604D22 |
| 6-Methyl-7-nitro (1H)indazole |
| 1H-Indazole, 6-methyl-7-nitro- |
| 6-Methyl-7-nitro-1H-indazole |
| 6-Methyl-7-nitro(1H)indazole |