1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthraquinone structure
|
Common Name | 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 71799-75-2 | Molecular Weight | 390.38900 | |
| Density | 1.466g/cm3 | Boiling Point | 732.1ºC at 760 mmHg | |
| Molecular Formula | C22H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 396.6ºC | |
| Name | 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 732.1ºC at 760 mmHg |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.38900 |
| Flash Point | 396.6ºC |
| Exact Mass | 390.12200 |
| PSA | 135.87000 |
| LogP | 4.26570 |
| Index of Refraction | 1.734 |
| InChIKey | PXJLVHHFOHMDIF-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(-c2cc(O)c3c(c2N)C(=O)c2c(O)ccc(N)c2C3=O)cc1 |
|
~%
1,5-diamino-2-(... CAS#:71799-75-2 |
| Literature: Cognard; Hieu Phan; Basturk Molecular crystals and liquid crystals, 1983 , vol. 91, # 3-4 p. 327 - 340 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| EINECS 276-034-7 |
| 1,5-Diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthraquinone |
| 1,5-Diamino-4,8-dihydroxy-2-(4-ethoxyphenyl)anthraquinone |
| Anthraquinone,1,5-diamino-2-(p-ethoxyphenyl)-4,8-dihydroxy-(7CI) |
| 9,10-Anthracenedione,1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxy |