1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthraquinone
1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthraquinone structure
|
Common Name | 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 71799-75-2 | Molecular Weight | 390.38900 | |
| Density | 1.466g/cm3 | Boiling Point | 732.1ºC at 760 mmHg | |
| Molecular Formula | C22H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 396.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 732.1ºC at 760 mmHg |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.38900 |
| Flash Point | 396.6ºC |
| Exact Mass | 390.12200 |
| PSA | 135.87000 |
| LogP | 4.26570 |
| Index of Refraction | 1.734 |
| InChIKey | PXJLVHHFOHMDIF-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(-c2cc(O)c3c(c2N)C(=O)c2c(O)ccc(N)c2C3=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,5-diamino-2-(... CAS#:71799-75-2 |
| Literature: Cognard; Hieu Phan; Basturk Molecular crystals and liquid crystals, 1983 , vol. 91, # 3-4 p. 327 - 340 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 276-034-7 |
| 1,5-Diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthraquinone |
| 1,5-Diamino-4,8-dihydroxy-2-(4-ethoxyphenyl)anthraquinone |
| Anthraquinone,1,5-diamino-2-(p-ethoxyphenyl)-4,8-dihydroxy-(7CI) |
| 9,10-Anthracenedione,1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione? |
| A: Molecular formula of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione is C22H18N2O5. |
| Q: What is the SMILES notation of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione? |
| A: SMILES notation of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione is CCOc1ccc(-c2cc(O)c3c(c2N)C(=O)c2c(O)ccc(N)c2C3=O)cc1. |
| Q: What are the upstream materials of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione? |
| A: Related upstream materials(CAS) of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione: 128-86-9;103-73-1. |
| Q: What is the CAS number of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione? |
| A: CAS number of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione is 71799-75-2. |
| Q: What is the boiling point of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione? |
| A: Boiling point of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione is 732.1ºC at 760 mmHg. |
| Q: What is the English name of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione? |
| A: The English name of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione is 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione. |
| Q: What is the polar surface area (PSA) of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione? |
| A: Polar surface area (PSA) of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione is 135.87000. |
| Q: What is the LogP of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione? |
| A: LogP of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione is 4.26570. |
| Q: What English synonyms does 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione have? |
| A: English synonyms of 1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthracene-9,10-dione: EINECS 276-034-7, 1,5-Diamino-2-(4-ethoxyphenyl)-4,8-dihydroxyanthraquinone, 1,5-Diamino-4,8-dihydroxy-2-(4-ethoxyphenyl)anthraquinone, Anthraquinone,1,5-diamino-2-(p-ethoxyphenyl)-4,8-dihydroxy-(7CI), 9,10-Anthracenedione,1,5-diamino-2-(4-ethoxyphenyl)-4,8-dihydroxy. |
| Q: What is the Chinese name of 71799-75-2? |
| A: Chinese name of 71799-75-2 is 71799-75-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |