(4E)-4-hydroxyimino-3-methyl-1-phenylpent-1-yn-3-ol structure
|
Common Name | (4E)-4-hydroxyimino-3-methyl-1-phenylpent-1-yn-3-ol | ||
|---|---|---|---|---|
| CAS Number | 718-21-8 | Molecular Weight | 203.23700 | |
| Density | 1.015g/cm3 | Boiling Point | 364.043ºC at 760 mmHg | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.227ºC | |
| Name | (4E)-4-hydroxyimino-3-methyl-1-phenylpent-1-yn-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.015g/cm3 |
|---|---|
| Boiling Point | 364.043ºC at 760 mmHg |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.23700 |
| Flash Point | 229.227ºC |
| Exact Mass | 203.09500 |
| PSA | 52.82000 |
| LogP | 1.63920 |
| Index of Refraction | 1.514 |
| InChIKey | OOBRKYBQULLXGD-JLHYYAGUSA-N |
| SMILES | CC(=NO)C(C)(O)C#Cc1ccccc1 |
| Ossima del 5-fenil-3-metilbutin-4-ol-3-one-2 |
| 3-Hydroxy-3-methyl-5-phenyl-but-4-in-2-on-oxim |
| 3-Hydroxy-3-methyl-5-phenyl-4-pentyn-2-one oxime |
| Ossima del 5-fenil-3-metilbutin-4-ol-3-one-2 [Italian] |
| Oxime of 5-phenyl-3-methylbutyne-4-ol-3-one-2 |
| 4-Pentyn-2-one,3-hydroxy-3-methyl-5-phenyl-,oxime |