N,N,4-trimethyl-1-phenylpent-1-yn-3-amine
N,N,4-trimethyl-1-phenylpent-1-yn-3-amine structure
|
Common Name | N,N,4-trimethyl-1-phenylpent-1-yn-3-amine | ||
|---|---|---|---|---|
| CAS Number | 718-30-9 | Molecular Weight | 201.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N,4-trimethyl-1-phenylpent-1-yn-3-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19N |
|---|---|
| Molecular Weight | 201.30700 |
| Exact Mass | 201.15200 |
| PSA | 3.24000 |
| LogP | 2.62430 |
| InChIKey | LUOYMQROCORDEF-UHFFFAOYSA-N |
| SMILES | CC(C)C(C#Cc1ccccc1)N(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~85%
N,N,4-trimethyl... CAS#:718-30-9 |
| Literature: Saidi, Mohammad R.; Nazari, Mohammad Monatshefte fur Chemie, 2004 , vol. 135, # 3 p. 309 - 312 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Pentyn-3-amine,N,N,4-trimethyl-1-phenyl |
| 4-Dimethylamino-4-methyl-1-phenylpent-1-yne |
| 3-Dimethylamino-4-methyl-1-phenyl-1-pentin |
| N,N,4-trimethyl-1-phenyl-1-pentyn-3-amine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine? |
| A: CAS number of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine is 718-30-9. |
| Q: What is the polar surface area (PSA) of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine? |
| A: Polar surface area (PSA) of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine is 3.24000. |
| Q: What is the SMILES notation of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine? |
| A: SMILES notation of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine is CC(C)C(C#Cc1ccccc1)N(C)C. |
| Q: What English synonyms does N,N,4-trimethyl-1-phenylpent-1-yn-3-amine have? |
| A: English synonyms of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine: 1-Pentyn-3-amine,N,N,4-trimethyl-1-phenyl, 4-Dimethylamino-4-methyl-1-phenylpent-1-yne, 3-Dimethylamino-4-methyl-1-phenyl-1-pentin, N,N,4-trimethyl-1-phenyl-1-pentyn-3-amine. |
| Q: What are the upstream materials of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine? |
| A: Related upstream materials(CAS) of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine: 2083-91-2;4890-63-5;78-84-2. |
| Q: What is the English name of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine? |
| A: The English name of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine is N,N,4-trimethyl-1-phenylpent-1-yn-3-amine. |
| Q: What is the Chinese name of 718-30-9? |
| A: Chinese name of 718-30-9 is 718-30-9. |
| Q: What is the molecular weight of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine? |
| A: Molecular weight of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine is 201.30700. |
| Q: What is the InChIKey of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine? |
| A: InChIKey of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine is LUOYMQROCORDEF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine? |
| A: Molecular formula of N,N,4-trimethyl-1-phenylpent-1-yn-3-amine is C14H19N. |