N-methyl-1-(4-nitrophenoxy)-N-phenyl-methanethioamide structure
|
Common Name | N-methyl-1-(4-nitrophenoxy)-N-phenyl-methanethioamide | ||
|---|---|---|---|---|
| CAS Number | 7180-27-0 | Molecular Weight | 288.32200 | |
| Density | 1.355g/cm3 | Boiling Point | 414.3ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.3ºC | |
| Name | O-(4-nitrophenyl) N-methyl-N-phenylcarbamothioate |
|---|
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 414.3ºC at 760 mmHg |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.32200 |
| Flash Point | 204.3ºC |
| Exact Mass | 288.05700 |
| PSA | 90.38000 |
| LogP | 3.91810 |
| Index of Refraction | 1.683 |
| InChIKey | FISPVHXJOIDMEB-UHFFFAOYSA-N |
| SMILES | CN(C(=S)Oc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
|
~%
N-methyl-1-(4-n... CAS#:7180-27-0 |
| Literature: Newman,M.S.; Karnes,H.A. Journal of Organic Chemistry, 1966 , vol. 31, p. 3980 - 3984 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |