kaempferol 3-O-alpha-L-arabinopyranosyl-7-O-alpha-L-rhamnopyranoside
Modify Date: 2025-08-28 19:41:47
kaempferol 3-O-alpha-L-arabinopyranosyl-7-O-alpha-L-rhamnopyranoside structure
|
Common Name | kaempferol 3-O-alpha-L-arabinopyranosyl-7-O-alpha-L-rhamnopyranoside | ||
|---|---|---|---|---|
| CAS Number | 71801-96-2 | Molecular Weight | 564.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H28O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | kaempferol 3-O-alpha-L-arabinopyranosyl-7-O-alpha-L-rhamnopyranoside |
|---|
| Molecular Formula | C26H28O14 |
|---|---|
| Molecular Weight | 564.5 |
| InChIKey | DQBVFTJNUYZVQL-CLFUFSEMSA-N |
| SMILES | CC1OC(Oc2cc(O)c3c(=O)c(OC4OCC(O)C(O)C4O)c(-c4ccc(O)cc4)oc3c2)C(O)C(O)C1O |
|
Name: Inhibition of wheat germ topoisomerase 1-mediated relaxation of supercoiled DNA at 50...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1932247
|
|
Name: Inhibition of human topoisomerase 2-mediated relation of supercoiled DNA at 100 to 10...
Source: ChEMBL
Target: DNA topoisomerase 2-alpha
External Id: CHEMBL1932265
|
|
Name: Inhibition of human topoisomerase 1-mediated relation of supercoiled DNA at 500 uM af...
Source: ChEMBL
Target: DNA topoisomerase 1
External Id: CHEMBL1932253
|
|
Name: Inhibition of human topoisomerase 2-mediated relation of supercoiled DNA at 500 uM af...
Source: ChEMBL
Target: DNA topoisomerase 2-alpha
External Id: CHEMBL1932254
|
Total 4, Current Page 1 of 1
1