Acetamide, N-(9-(4-(ethylsulfonamido)-2-methoxyanilino)-3-acridinyl)-,monohydrochloride structure
|
Common Name | Acetamide, N-(9-(4-(ethylsulfonamido)-2-methoxyanilino)-3-acridinyl)-,monohydrochloride | ||
|---|---|---|---|---|
| CAS Number | 71802-77-2 | Molecular Weight | 500.99800 | |
| Density | N/A | Boiling Point | 707.7ºC at 760 mmHg | |
| Molecular Formula | C24H25ClN4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 381.8ºC | |
| Name | N-[9-[4-(ethylsulfonylamino)-2-methoxyanilino]acridin-3-yl]acetamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 707.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C24H25ClN4O4S |
| Molecular Weight | 500.99800 |
| Flash Point | 381.8ºC |
| Exact Mass | 500.12900 |
| PSA | 124.52000 |
| LogP | 6.88740 |
| InChIKey | LMVUAVACFUEPDU-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)Nc1ccc(Nc2c3ccccc3nc3cc(NC(C)=O)ccc23)c(OC)c1.Cl |
|
Name: Dissociation constant, pKa of the compound by UV spectrophotometric analysis
Source: ChEMBL
Target: N/A
External Id: CHEMBL3253876
|
|
Name: Logarithmic function of the retardation factor of the compound by reverse-phase chrom...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3253875
|
|
Name: Antitumor activity against mouse L1210 cells allografted in mouse assessed as dose re...
Source: ChEMBL
Target: L1210
External Id: CHEMBL3253878
|
|
Name: Toxicity in mouse L1210 cells xenografted mouse assessed as compound proving lethal t...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL3253877
|
|
Name: Antitumor activity against mouse L1210 cells allografted in mouse assessed as maximum...
Source: ChEMBL
Target: L1210
External Id: CHEMBL3253879
|
| N-[9-[4-(ethylsulfonylamino)-2-methoxyanilino]acridin-3-yl]acetamide hydrochloride |
| 4'-(3-Acetamido-9-acridinylamino)-3'-methoxyethanesulfonanilide hydrochloride |
| Acetamide,N-(9-(4-(ethylsulfonamido)-2-methoxyanilino)-3-acridinyl)-,monohydrochloride |
| Ethanesulfonanilide,4'-(3-acetamido-9-acridinylamino)-3'-methoxy-,hydrochloride |