Benzoic acid, 4-((phenylmethylene)amino)-, ethyl ester
Modify Date: 2025-09-19 15:32:41
Benzoic acid, 4-((phenylmethylene)amino)-, ethyl ester structure
|
Common Name | Benzoic acid, 4-((phenylmethylene)amino)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7182-99-2 | Molecular Weight | 253.29600 | |
| Density | 1.05g/cm3 | Boiling Point | 401.2ºC at 760 mmHg | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.5ºC | |
| Name | ethyl 4-(benzylideneamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 401.2ºC at 760 mmHg |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.29600 |
| Flash Point | 176.5ºC |
| Exact Mass | 253.11000 |
| PSA | 38.66000 |
| LogP | 3.61390 |
| Index of Refraction | 1.546 |
| InChIKey | UEDPIABBBXACGR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N=Cc2ccccc2)cc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:94-09-7| ethyl ester of 4-benzylideneaminobenzoic acid |
| PhC(H)=NC6H4CO2Et-p |
| Benzoic acid,4-((phenylmethylene)amino)-,ethyl ester |
| Ethyl 4-((phenylmethylene)amino)benzoate |
| ethyl N-benzylidene-p-aminobenzoate |
| ethyl p-benzylideneaminobenzoate |
| Ethyl p-(N-benzylideneamino)benzoate |
| 4-Benzylidenamino-benzoesaeure-aethylester |
| 4-Benzylideneaminobenzoic acid ethyl ester |
| EINECS 230-549-3 |
| ethyl 4-{[(e)-phenylmethylidene]amino}benzoate |
| 4-benzylidenamino-benzoic acid ethyl ester |
| Benzoic acid,p-(benzylideneamino)-,ethyl ester |
| N-Benzylidene-p-ethoxycarbonylaniline |