2-[2-(2,3-dihydro-1,3-dioxo-1H-inden-2-yl)quinolin-6-yl]-6-methylbenzothiazole-7-sulphonic acid, compound with 2,2',2''-nitrilotris[ethanol] (1:1) structure
|
Common Name | 2-[2-(2,3-dihydro-1,3-dioxo-1H-inden-2-yl)quinolin-6-yl]-6-methylbenzothiazole-7-sulphonic acid, compound with 2,2',2''-nitrilotris[ethanol] (1:1) | ||
|---|---|---|---|---|
| CAS Number | 71832-69-4 | Molecular Weight | 649.73400 | |
| Density | N/A | Boiling Point | 958.5ºC at 760 mmHg | |
| Molecular Formula | C32H31N3O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 533.5ºC | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,2-[2-(1,3-dioxoinden-2-yl)quinolin-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid |
|---|
| Boiling Point | 958.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C32H31N3O8S2 |
| Molecular Weight | 649.73400 |
| Flash Point | 533.5ºC |
| Exact Mass | 649.15500 |
| PSA | 214.84000 |
| LogP | 4.57550 |
| InChIKey | JADMHUDNCZNLEW-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(-c3ccc4nc(C5C(=O)c6ccccc6C5=O)ccc4c3)sc2c1S(=O)(=O)O.OCCN(CCO)CCO |