2-[2-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]ethoxy]ethyl N-[4-[(4-isocyanatophenyl)methyl]phenyl]carbamate structure
|
Common Name | 2-[2-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]ethoxy]ethyl N-[4-[(4-isocyanatophenyl)methyl]phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 71832-70-7 | Molecular Weight | 606.62500 | |
| Density | 1.23g/cm3 | Boiling Point | 692.4ºC at 760 mmHg | |
| Molecular Formula | C34H30N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 372.6ºC | |
| Name | 2-[2-[[4-[(4-isocyanatophenyl)methyl]phenyl]carbamoyloxy]ethoxy]ethyl N-[4-[(4-isocyanatophenyl)methyl]phenyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 692.4ºC at 760 mmHg |
| Molecular Formula | C34H30N4O7 |
| Molecular Weight | 606.62500 |
| Flash Point | 372.6ºC |
| Exact Mass | 606.21100 |
| PSA | 144.75000 |
| LogP | 6.76260 |
| Index of Refraction | 1.602 |
| InChIKey | ZHOZEBCEPVYWQJ-UHFFFAOYSA-N |
| SMILES | O=C=Nc1ccc(Cc2ccc(NC(=O)OCCOCCOC(=O)Nc3ccc(Cc4ccc(N=C=O)cc4)cc3)cc2)cc1 |
| Carbamicacid,[4-[(4-isocyanatophenyl)methyl]phenyl]-,oxydi-2,1-ethanediyl ester (9CI) |
| Carbamic acid,(4-((4-isocyanatophenyl)methyl)phenyl)-,oxydi-2,1-ethanediyl ester |
| EINECS 276-050-4 |
| Diethylene glycol,urethane (1:2) with methylenedi-p-phenylene isocyanate |
| OXYDIETHYLENE BIS[[4-[(4-ISOCYANATOPHENYL)METHYL]PHENYL]CARBAMATE] |