1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-,2,3-d ihydroxypropyl ester structure
|
Common Name | 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-,2,3-d ihydroxypropyl ester | ||
|---|---|---|---|---|
| CAS Number | 71848-87-8 | Molecular Weight | 431.86600 | |
| Density | 1.34g/cm3 | Boiling Point | 583.7ºC at 760 mmHg | |
| Molecular Formula | C22H22ClNO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.8ºC | |
| Name | 2,3-dihydroxypropyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 583.7ºC at 760 mmHg |
| Molecular Formula | C22H22ClNO6 |
| Molecular Weight | 431.86600 |
| Flash Point | 306.8ºC |
| Exact Mass | 431.11400 |
| PSA | 97.99000 |
| LogP | 2.73910 |
| Index of Refraction | 1.604 |
| InChIKey | AXVIECLQBNZXKG-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)c(CC(=O)OCC(O)CO)c(C)n2C(=O)c1ccc(Cl)cc1 |
|
~%
1H-Indole-3-ace... CAS#:71848-87-8 |
| Literature: Paris; Garmaise; Cimon; Swett; Carter; Young Journal of Medicinal Chemistry, 1980 , vol. 23, # 1 p. 9 - 13 |
|
~%
1H-Indole-3-ace... CAS#:71848-87-8 |
| Literature: Paris; Garmaise; Cimon; Swett; Carter; Young Journal of Medicinal Chemistry, 1980 , vol. 23, # 1 p. 9 - 13 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-[1-(p-chlorobenzoyl)-5-methoxy-2-methylindole-3-acetyl]glyceride |
| 2,3-dihydroxypropyl [1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate |
| 1H-Indole-3-acetic acid,1-(4-chlorobenzoyl)-5-methoxy-2-methyl-,2,3-dihydroxypropyl ester |