Uridine 5'-monophosphate, monoanhydride with (phosphonomethyl)phosphonic acid
Modify Date: 2025-09-21 23:32:09
Uridine 5'-monophosphate, monoanhydride with (phosphonomethyl)phosphonic acid structure
|
Common Name | Uridine 5'-monophosphate, monoanhydride with (phosphonomethyl)phosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 71850-06-1 | Molecular Weight | 482.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17N2O14P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Uridine 5'-monophosphate, monoanhydride with (phosphonomethyl)phosphonic acid |
|---|
| Molecular Formula | C10H17N2O14P3 |
|---|---|
| Molecular Weight | 482.17 |
| InChIKey | YAMUBYIKSYFVRX-ZOQUXTDFSA-N |
| SMILES | O=c1ccn(C2OC(COP(=O)(O)OP(=O)(O)CP(=O)(O)O)C(O)C2O)c(=O)[nH]1 |