lithium,chloromethyl-dimethyl-phenylsilane
lithium,chloromethyl-dimethyl-phenylsilane structure
|
Common Name | lithium,chloromethyl-dimethyl-phenylsilane | ||
|---|---|---|---|---|
| CAS Number | 71864-24-9 | Molecular Weight | 190.67100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12ClLiSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | lithium,chloromethyl-dimethyl-phenylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H12ClLiSi |
|---|---|
| Molecular Weight | 190.67100 |
| Exact Mass | 190.05600 |
| LogP | 2.18220 |
| InChIKey | PQTHTYRONVMBMI-UHFFFAOYSA-N |
| SMILES | C[Si](C)([CH-]Cl)c1ccccc1.[Li+] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 7 | |
CAS#:112197-44-1
CAS#:17938-20-4
CAS#:111-65-9
CAS#:768-32-1
CAS#:25284-37-1
CAS#:92-52-4
CAS#:120059-88-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Lithium,[chloro(dimethylphenylsilyl)methyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of lithium,chloromethyl-dimethyl-phenylsilane? |
| A: Molecular formula of lithium,chloromethyl-dimethyl-phenylsilane is C9H12ClLiSi. |
| Q: What are the downstream products of lithium,chloromethyl-dimethyl-phenylsilane? |
| A: Related downstream products(CAS) of lithium,chloromethyl-dimethyl-phenylsilane: 112197-44-1;17938-20-4;111-65-9;768-32-1;25284-37-1;92-52-4;120059-88-3. |
| Q: What is the molecular weight of lithium,chloromethyl-dimethyl-phenylsilane? |
| A: Molecular weight of lithium,chloromethyl-dimethyl-phenylsilane is 190.67100. |
| Q: What English synonyms does lithium,chloromethyl-dimethyl-phenylsilane have? |
| A: English synonyms of lithium,chloromethyl-dimethyl-phenylsilane: Lithium,[chloro(dimethylphenylsilyl)methyl]. |
| Q: What is the InChIKey of lithium,chloromethyl-dimethyl-phenylsilane? |
| A: InChIKey of lithium,chloromethyl-dimethyl-phenylsilane is PQTHTYRONVMBMI-UHFFFAOYSA-N. |
| Q: What is the English name of lithium,chloromethyl-dimethyl-phenylsilane? |
| A: The English name of lithium,chloromethyl-dimethyl-phenylsilane is lithium,chloromethyl-dimethyl-phenylsilane. |
| Q: What is the CAS number of lithium,chloromethyl-dimethyl-phenylsilane? |
| A: CAS number of lithium,chloromethyl-dimethyl-phenylsilane is 71864-24-9. |
| Q: What is the LogP of lithium,chloromethyl-dimethyl-phenylsilane? |
| A: LogP of lithium,chloromethyl-dimethyl-phenylsilane is 2.18220. |
| Q: What is the SMILES notation of lithium,chloromethyl-dimethyl-phenylsilane? |
| A: SMILES notation of lithium,chloromethyl-dimethyl-phenylsilane is C[Si](C)([CH-]Cl)c1ccccc1.[Li+]. |
| Q: What is the Chinese name of 71864-24-9? |
| A: Chinese name of 71864-24-9 is 71864-24-9. |