6-Tosyl-6-deoxygalactose
Modify Date: 2026-07-05 20:07:58
6-Tosyl-6-deoxygalactose structure
|
Common Name | 6-Tosyl-6-deoxygalactose | ||
|---|---|---|---|---|
| CAS Number | 71866-38-1 | Molecular Weight | 318.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Tosyl-6-deoxygalactose |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18O7S |
|---|---|
| Molecular Weight | 318.34 |
| InChIKey | CEIQGXFNETWJNQ-LOWDOPEQSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CC(O)C(O)C(O)C(O)C=O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6-Tosyl-6-deoxygalactose? |
| A: The English name of 6-Tosyl-6-deoxygalactose is 6-Tosyl-6-deoxygalactose. |
| Q: What is the SMILES notation of 6-Tosyl-6-deoxygalactose? |
| A: SMILES notation of 6-Tosyl-6-deoxygalactose is Cc1ccc(S(=O)(=O)CC(O)C(O)C(O)C(O)C=O)cc1. |
| Q: What is the Chinese name of 71866-38-1? |
| A: Chinese name of 71866-38-1 is 71866-38-1. |
| Q: What is the molecular weight of 6-Tosyl-6-deoxygalactose? |
| A: Molecular weight of 6-Tosyl-6-deoxygalactose is 318.34. |
| Q: What is the InChIKey of 6-Tosyl-6-deoxygalactose? |
| A: InChIKey of 6-Tosyl-6-deoxygalactose is CEIQGXFNETWJNQ-LOWDOPEQSA-N. |
| Q: What is the CAS number of 6-Tosyl-6-deoxygalactose? |
| A: CAS number of 6-Tosyl-6-deoxygalactose is 71866-38-1. |
| Q: What is the molecular formula of 6-Tosyl-6-deoxygalactose? |
| A: Molecular formula of 6-Tosyl-6-deoxygalactose is C13H18O7S. |