Pyridine,3-(3-phenyl-1h-pyrazol-1-yl)
Modify Date: 2026-07-31 12:11:54
Pyridine,3-(3-phenyl-1h-pyrazol-1-yl) structure
|
Common Name | Pyridine,3-(3-phenyl-1h-pyrazol-1-yl) | ||
|---|---|---|---|---|
| CAS Number | 7188-75-2 | Molecular Weight | 221.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Pyridine,3-(3-phenyl-1h-pyrazol-1-yl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11N3 |
|---|---|
| Molecular Weight | 221.26 |
| InChIKey | UIDFNGFSDVHUGX-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccn(-c3cccnc3)n2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Pyridine,3-(3-phenyl-1h-pyrazol-1-yl)? |
| A: SMILES notation of Pyridine,3-(3-phenyl-1h-pyrazol-1-yl) is c1ccc(-c2ccn(-c3cccnc3)n2)cc1. |
| Q: What is the InChIKey of Pyridine,3-(3-phenyl-1h-pyrazol-1-yl)? |
| A: InChIKey of Pyridine,3-(3-phenyl-1h-pyrazol-1-yl) is UIDFNGFSDVHUGX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Pyridine,3-(3-phenyl-1h-pyrazol-1-yl)? |
| A: Molecular formula of Pyridine,3-(3-phenyl-1h-pyrazol-1-yl) is C14H11N3. |
| Q: What is the English name of Pyridine,3-(3-phenyl-1h-pyrazol-1-yl)? |
| A: The English name of Pyridine,3-(3-phenyl-1h-pyrazol-1-yl) is Pyridine,3-(3-phenyl-1h-pyrazol-1-yl). |
| Q: What is the CAS number of Pyridine,3-(3-phenyl-1h-pyrazol-1-yl)? |
| A: CAS number of Pyridine,3-(3-phenyl-1h-pyrazol-1-yl) is 7188-75-2. |
| Q: What is the molecular weight of Pyridine,3-(3-phenyl-1h-pyrazol-1-yl)? |
| A: Molecular weight of Pyridine,3-(3-phenyl-1h-pyrazol-1-yl) is 221.26. |
| Q: What is the Chinese name of 7188-75-2? |
| A: Chinese name of 7188-75-2 is 7188-75-2. |