[bis(4-amino-3,5-dimethylphenyl)-(2,6-dichlorophenyl)methoxy]boronic acid structure
|
Common Name | [bis(4-amino-3,5-dimethylphenyl)-(2,6-dichlorophenyl)methoxy]boronic acid | ||
|---|---|---|---|---|
| CAS Number | 71889-05-9 | Molecular Weight | 459.17300 | |
| Density | 1.313g/cm3 | Boiling Point | 658.5ºC at 760 mmHg | |
| Molecular Formula | C23H25BCl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 352ºC | |
| Name | [bis(4-amino-3,5-dimethylphenyl)-(2,6-dichlorophenyl)methoxy]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 658.5ºC at 760 mmHg |
| Molecular Formula | C23H25BCl2N2O3 |
| Molecular Weight | 459.17300 |
| Flash Point | 352ºC |
| Exact Mass | 458.13400 |
| PSA | 101.73000 |
| LogP | 5.83180 |
| Index of Refraction | 1.635 |
| InChIKey | YAFGLTCOVKGWQR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(OB(O)O)(c2cc(C)c(N)c(C)c2)c2c(Cl)cccc2Cl)cc(C)c1N |
| 4,4'-Diamino-3,3',5,5'-tetramethyl-2'',6''-trityl alcohol,monoester with boric acid |
| EINECS 276-164-4 |