Prostaglandin D3 structure
|
Common Name | Prostaglandin D3 | ||
|---|---|---|---|---|
| CAS Number | 71902-47-1 | Molecular Weight | 350.45 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 561.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.2±26.6 °C | |
Use of Prostaglandin D3Prostaglandin D3 (PGD3) is a prostaglandin that acts as an inhibitor of platelet aggregation and a modulator of autonomic neurotransmission in humans[1]. |
| Name | prostaglandin D3 |
|---|---|
| Synonym | More Synonyms |
| Description | Prostaglandin D3 (PGD3) is a prostaglandin that acts as an inhibitor of platelet aggregation and a modulator of autonomic neurotransmission in humans[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 561.2±50.0 °C at 760 mmHg |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.45 |
| Flash Point | 307.2±26.6 °C |
| Exact Mass | 350.209320 |
| PSA | 94.83000 |
| LogP | 1.57 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | ANOICLBSJIMQTA-WXGBOJPQSA-N |
| SMILES | CCC=CCC(O)C=CC1C(=O)CC(O)C1CC=CCCCC(=O)O |
| 9S,15S-dihydroxy-11-oxo-5Z,13E,17Z-prostatrienoic acid |
| PGD3 |
| Prosta-5,13,17-trien-1-oic acid, 9,15-dihydroxy-11-oxo-, (5Z,9α,13E,15S,17Z)- |
| Prostaglandin D3 |
| (5Z,9α,13E,15S,17Z)-9,15-Dihydroxy-11-oxoprosta-5,13,17-trien-1-oic acid |
| (Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(1E,3S,5Z)-3-hydroxyocta-1,5-dienyl]-3-oxocyclopentyl]hept-5-enoic acid |