3-hydroxymethylphenytoin N,N-dimethylglycine ester structure
|
Common Name | 3-hydroxymethylphenytoin N,N-dimethylglycine ester | ||
|---|---|---|---|---|
| CAS Number | 71919-15-8 | Molecular Weight | 463.50400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H25N3O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl 2-(dimethylamino)acetate,methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H25N3O7S |
|---|---|
| Molecular Weight | 463.50400 |
| Exact Mass | 463.14100 |
| PSA | 145.19000 |
| LogP | 1.70700 |
| InChIKey | YCWCKDBGASXITB-UHFFFAOYSA-N |
| SMILES | CN(C)CC(=O)OCN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O.CS(=O)(=O)O |
|
~94%
3-hydroxymethyl... CAS#:71919-15-8 |
| Literature: Varia; Schuller; Sloan; Stella Journal of Pharmaceutical Sciences, 1984 , vol. 73, # 8 p. 1068 - 1073 |
|
~%
3-hydroxymethyl... CAS#:71919-15-8 |
| Literature: Varia; Schuller; Sloan; Stella Journal of Pharmaceutical Sciences, 1984 , vol. 73, # 8 p. 1068 - 1073 |
|
~%
3-hydroxymethyl... CAS#:71919-15-8 |
| Literature: Varia; Schuller; Sloan; Stella Journal of Pharmaceutical Sciences, 1984 , vol. 73, # 8 p. 1068 - 1073 |
| 3-Hydroxymethylphenytoin N,N-dimethylglycine ester |
| (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl 2-(dimethylamino)acetate |
| Hdh odge |
| 3-(hydroxymethyl)-5,5-diphenylhydantoin N,N-dimethylglycine ester,monomethanesulfonate salt |