(4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol
Modify Date: 2026-07-10 07:24:14
![(4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol Structure](https://www.chemsrc.com/extcaspic/344/71925-95-6.png)
(4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol structure
|
Common Name | (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol | ||
|---|---|---|---|---|
| CAS Number | 71925-95-6 | Molecular Weight | 308.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20O6 |
|---|---|
| Molecular Weight | 308.33 |
| InChIKey | OMBCPFYQIULSGV-XSYLOXKBSA-N |
| SMILES | C=CCOC1OC2COC(c3ccccc3)OC2C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol? |
| A: The English name of (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol is (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol. |
| Q: What is the SMILES notation of (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol? |
| A: SMILES notation of (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol is C=CCOC1OC2COC(c3ccccc3)OC2C(O)C1O. |
| Q: What is the molecular weight of (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol? |
| A: Molecular weight of (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol is 308.33. |
| Q: What is the InChIKey of (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol? |
| A: InChIKey of (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol is OMBCPFYQIULSGV-XSYLOXKBSA-N. |
| Q: What is the molecular formula of (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol? |
| A: Molecular formula of (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol is C16H20O6. |
| Q: What is the CAS number of (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol? |
| A: CAS number of (4aR,6R,7R,8R,8aR)-6-(Allyloxy)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diol is 71925-95-6. |
| Q: What is the Chinese name of 71925-95-6? |
| A: Chinese name of 71925-95-6 is 71925-95-6. |