1H-Pyrazole,4-chloro-1-hydroxy-3,5-diphenyl-, 2-oxide structure
|
Common Name | 1H-Pyrazole,4-chloro-1-hydroxy-3,5-diphenyl-, 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 71989-60-1 | Molecular Weight | 286.71300 | |
| Density | 1.33g/cm3 | Boiling Point | 497.2ºC at 760 mmHg | |
| Molecular Formula | C15H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.5ºC | |
| Name | 4-chloro-1-hydroxy-2-oxido-3,5-diphenylpyrazol-2-ium |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 497.2ºC at 760 mmHg |
| Molecular Formula | C15H11ClN2O2 |
| Molecular Weight | 286.71300 |
| Flash Point | 254.5ºC |
| Exact Mass | 286.05100 |
| PSA | 50.62000 |
| LogP | 4.14130 |
| Index of Refraction | 1.651 |
| InChIKey | PMOOVQFACVSERI-UHFFFAOYSA-N |
| SMILES | [O-][n+]1c(-c2ccccc2)c(Cl)c(-c2ccccc2)n1O |
|
~93%
1H-Pyrazole,4-c... CAS#:71989-60-1 |
| Literature: Hansen, John F.; Kim, Yong In; Griswold, Linus J.; Hoelle, Gary W.; Taylor, Deborah L.; Vietti, David E. Journal of Organic Chemistry, 1980 , vol. 45, # 1 p. 76 - 80 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |