5-[4-(Trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-amine structure
|
Common Name | 5-[4-(Trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 720-76-3 | Molecular Weight | 230.18600 | |
| Density | 1.45g/cm3 | Boiling Point | 301.8ºC at 760 mmHg | |
| Molecular Formula | C10H9F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.3ºC | |
| Name | 5-[4-(Trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 301.8ºC at 760 mmHg |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.18600 |
| Flash Point | 136.3ºC |
| Exact Mass | 230.06700 |
| PSA | 45.11000 |
| LogP | 2.72960 |
| Index of Refraction | 1.543 |
| InChIKey | NMGYDYBWRZHLHR-UHFFFAOYSA-N |
| SMILES | NC1=NCC(c2ccc(C(F)(F)F)cc2)O1 |
|
~%
5-[4-(Trifluoro... CAS#:720-76-3 |
| Literature: Poos,G.I. et al. Journal of Medicinal Chemistry, 1963 , vol. 6, p. 266 - 272 |
|
~%
5-[4-(Trifluoro... CAS#:720-76-3 |
| Literature: Poos,G.I. et al. Journal of Medicinal Chemistry, 1963 , vol. 6, p. 266 - 272 |
| 5-(4-trifluoromethyl-phenyl)-4,5-dihydro-oxazol-2-ylamine |
| 2-Amino-5-p-trifluormethylphenyl-2-oxazolin |
| Fluminorex |
| Fluminorex [USAN:INN] |
| MCN-1231 |
| 2-Amino-5-(p-trifluormethyl)oxazolin |
| 2-Amino-5-(4-trifluormethylphenyl)-oxazolin |
| UNII-LUO2Z7954T |