tert-Butyl(3,4-dihydroxyphenyl) ketone
tert-Butyl(3,4-dihydroxyphenyl) ketone structure
|
Common Name | tert-Butyl(3,4-dihydroxyphenyl) ketone | ||
|---|---|---|---|---|
| CAS Number | 72017-59-5 | Molecular Weight | 194.22700 | |
| Density | 1.16g/cm3 | Boiling Point | 373ºC at 760mmHg | |
| Molecular Formula | C11H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 373ºC at 760mmHg |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.22700 |
| Flash Point | 193.6ºC |
| Exact Mass | 194.09400 |
| PSA | 57.53000 |
| LogP | 2.32660 |
| Index of Refraction | 1.557 |
| InChIKey | PYYHPJWXMOZDTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)c1ccc(O)c(O)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
tert-Butyl(3,4-... CAS#:72017-59-5 |
| Literature: Moffett,R.B. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 178 - 186 |
|
~%
tert-Butyl(3,4-... CAS#:72017-59-5 |
| Literature: Moffett,R.B. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 178 - 186 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tert-BUTYROPHENONE,3',4'-DIHYDROXY |
| 3',4'-Dihydroxy-2,2-dimethyl-propiophenon |
| 3',4'-Dihydroxy-tert-butyrophenone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one? |
| A: LogP of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one is 2.32660. |
| Q: What is the SMILES notation of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one? |
| A: SMILES notation of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one is CC(C)(C)C(=O)c1ccc(O)c(O)c1. |
| Q: What is the English name of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one? |
| A: The English name of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one is 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one. |
| Q: What is the polar surface area (PSA) of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one? |
| A: Polar surface area (PSA) of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one is 57.53000. |
| Q: What is the molecular formula of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one? |
| A: Molecular formula of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one is C11H14O3. |
| Q: What is the molecular weight of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one? |
| A: Molecular weight of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one is 194.22700. |
| Q: What is the CAS number of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one? |
| A: CAS number of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one is 72017-59-5. |
| Q: What is the InChIKey of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one? |
| A: InChIKey of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one is PYYHPJWXMOZDTP-UHFFFAOYSA-N. |
| Q: What is the boiling point of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one? |
| A: Boiling point of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one is 373ºC at 760mmHg. |
| Q: What English synonyms does 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one have? |
| A: English synonyms of 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one: tert-BUTYROPHENONE,3',4'-DIHYDROXY, 3',4'-Dihydroxy-2,2-dimethyl-propiophenon, 3',4'-Dihydroxy-tert-butyrophenone. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |