tert-Butyl(3,4-dihydroxyphenyl) ketone structure
|
Common Name | tert-Butyl(3,4-dihydroxyphenyl) ketone | ||
|---|---|---|---|---|
| CAS Number | 72017-59-5 | Molecular Weight | 194.22700 | |
| Density | 1.16g/cm3 | Boiling Point | 373ºC at 760mmHg | |
| Molecular Formula | C11H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | 1-(3,4-dihydroxyphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 373ºC at 760mmHg |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.22700 |
| Flash Point | 193.6ºC |
| Exact Mass | 194.09400 |
| PSA | 57.53000 |
| LogP | 2.32660 |
| Index of Refraction | 1.557 |
| InChIKey | PYYHPJWXMOZDTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)c1ccc(O)c(O)c1 |
|
~%
tert-Butyl(3,4-... CAS#:72017-59-5 |
| Literature: Moffett,R.B. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 178 - 186 |
|
~%
tert-Butyl(3,4-... CAS#:72017-59-5 |
| Literature: Moffett,R.B. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 178 - 186 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| tert-BUTYROPHENONE,3',4'-DIHYDROXY |
| 3',4'-Dihydroxy-2,2-dimethyl-propiophenon |
| 3',4'-Dihydroxy-tert-butyrophenone |