Maleic anhydride,neopentyl glycol,dicyclopentadiene polymer structure
|
Common Name | Maleic anhydride,neopentyl glycol,dicyclopentadiene polymer | ||
|---|---|---|---|---|
| CAS Number | 72018-16-7 | Molecular Weight | 334.40700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Maleic anhydride,neopentyl glycol,dicyclopentadiene polymer |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H26O5 |
|---|---|
| Molecular Weight | 334.40700 |
| Exact Mass | 334.17800 |
| PSA | 83.83000 |
| LogP | 2.00780 |
| InChIKey | AJXKEIGCFWCORN-UHFFFAOYSA-N |
| SMILES | C1=CC2C3C=CC(C3)C2C1.CC(C)(CO)CO.O=C1C=CC(=O)O1 |
| 2,5-Furandione,polymer with 2,2-dimethyl-1,3-propanediol and 3a,4,7,7a-tetrahydro-4,7-methano-1H-indene |