Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate
Modify Date: 2026-07-17 17:21:58
Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate structure
|
Common Name | Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 72030-75-2 | Molecular Weight | 180.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8N2O3 |
|---|---|
| Molecular Weight | 180.16 |
| InChIKey | UNUGAZVWALMTOB-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]Cc1ocnc1C(=O)OCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate? |
| A: CAS number of Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate is 72030-75-2. |
| Q: What is the English name of Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate? |
| A: The English name of Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate is Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate. |
| Q: What is the molecular weight of Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate? |
| A: Molecular weight of Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate is 180.16. |
| Q: What is the SMILES notation of Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate? |
| A: SMILES notation of Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate is [C-]#[N+]Cc1ocnc1C(=O)OCC. |
| Q: What is the molecular formula of Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate? |
| A: Molecular formula of Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate is C8H8N2O3. |
| Q: What is the Chinese name of 72030-75-2? |
| A: Chinese name of 72030-75-2 is 72030-75-2. |
| Q: What is the InChIKey of Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate? |
| A: InChIKey of Ethyl 5-(isocyanomethyl)-1,3-oxazole-4-carboxylate is UNUGAZVWALMTOB-UHFFFAOYSA-N. |