Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate
Modify Date: 2025-09-14 20:45:25
Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate structure
|
Common Name | Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 72030-86-5 | Molecular Weight | 248.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8N2O5 |
|---|---|
| Molecular Weight | 248.19 |
| InChIKey | DLDCGEOSJDASMN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ncoc1-c1ccc([N+](=O)[O-])cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate? |
| A: CAS number of Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is 72030-86-5. |
| Q: What is the Chinese name of 72030-86-5? |
| A: Chinese name of 72030-86-5 is 72030-86-5. |
| Q: What is the SMILES notation of Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate? |
| A: SMILES notation of Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is COC(=O)c1ncoc1-c1ccc([N+](=O)[O-])cc1. |
| Q: What is the molecular weight of Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate? |
| A: Molecular weight of Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is 248.19. |
| Q: What is the English name of Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate? |
| A: The English name of Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate. |
| Q: What is the InChIKey of Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate? |
| A: InChIKey of Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is DLDCGEOSJDASMN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate? |
| A: Molecular formula of Methyl 5-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is C11H8N2O5. |