4-((((4-Methoxyphenyl)sulfonyl)oxy)imino)cyclohexa-2,5-dienone
Modify Date: 2026-04-01 21:14:28
4-((((4-Methoxyphenyl)sulfonyl)oxy)imino)cyclohexa-2,5-dienone structure
|
Common Name | 4-((((4-Methoxyphenyl)sulfonyl)oxy)imino)cyclohexa-2,5-dienone | ||
|---|---|---|---|---|
| CAS Number | 7204-20-8 | Molecular Weight | 293.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-((((4-Methoxyphenyl)sulfonyl)oxy)imino)cyclohexa-2,5-dienone |
|---|
| Molecular Formula | C13H11NO5S |
|---|---|
| Molecular Weight | 293.3 |
| InChIKey | YRJBOECKYZWCJM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)ON=C2C=CC(=O)C=C2 |
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 2, Current Page 1 of 1
1