4,7-diphenyl-1,3-benzodioxole-5,6-dione
4,7-diphenyl-1,3-benzodioxole-5,6-dione structure
|
Common Name | 4,7-diphenyl-1,3-benzodioxole-5,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7204-23-1 | Molecular Weight | 304.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,7-diphenyl-1,3-benzodioxole-5,6-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H12O4 |
|---|---|
| Molecular Weight | 304.29600 |
| Exact Mass | 304.07400 |
| PSA | 52.60000 |
| LogP | 2.96510 |
| InChIKey | XYMMGDPUFCLMOA-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)C(c2ccccc2)=C2OCOC2=C1c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
![4,8-diphenylbenzo[1,2-d:4,5-d']bis([1,3]dioxole) Structure](https://image.chemsrc.com/caspic/448/1040171-12-7.png)
CAS#:1040171-12-7![2,2-dimethyl-4,8-diphenylbenzo[1,2-d:4,5-d']bis([1,3]dioxole) Structure](https://image.chemsrc.com/caspic/042/1040170-94-2.png)
CAS#:1040170-94-2
CAS#:844-51-9
CAS#:20955-74-2
CAS#:803725-40-8
CAS#:803725-39-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| phlebiarubrone |
| 4,7-diphenyl-benzo[1,3]dioxole-5,6-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4,7-diphenyl-1,3-benzodioxole-5,6-dione? |
| A: Molecular weight of 4,7-diphenyl-1,3-benzodioxole-5,6-dione is 304.29600. |
| Q: What is the molecular formula of 4,7-diphenyl-1,3-benzodioxole-5,6-dione? |
| A: Molecular formula of 4,7-diphenyl-1,3-benzodioxole-5,6-dione is C19H12O4. |
| Q: What is the polar surface area (PSA) of 4,7-diphenyl-1,3-benzodioxole-5,6-dione? |
| A: Polar surface area (PSA) of 4,7-diphenyl-1,3-benzodioxole-5,6-dione is 52.60000. |
| Q: What is the CAS number of 4,7-diphenyl-1,3-benzodioxole-5,6-dione? |
| A: CAS number of 4,7-diphenyl-1,3-benzodioxole-5,6-dione is 7204-23-1. |
| Q: What is the InChIKey of 4,7-diphenyl-1,3-benzodioxole-5,6-dione? |
| A: InChIKey of 4,7-diphenyl-1,3-benzodioxole-5,6-dione is XYMMGDPUFCLMOA-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4,7-diphenyl-1,3-benzodioxole-5,6-dione? |
| A: SMILES notation of 4,7-diphenyl-1,3-benzodioxole-5,6-dione is O=C1C(=O)C(c2ccccc2)=C2OCOC2=C1c1ccccc1. |
| Q: What is the LogP of 4,7-diphenyl-1,3-benzodioxole-5,6-dione? |
| A: LogP of 4,7-diphenyl-1,3-benzodioxole-5,6-dione is 2.96510. |
| Q: What are the upstream materials of 4,7-diphenyl-1,3-benzodioxole-5,6-dione? |
| A: Related upstream materials(CAS) of 4,7-diphenyl-1,3-benzodioxole-5,6-dione: 1040171-12-7;1040170-94-2;844-51-9;20955-74-2;803725-40-8;803725-39-5. |
| Q: What is the Chinese name of 7204-23-1? |
| A: Chinese name of 7204-23-1 is 7204-23-1. |
| Q: What English synonyms does 4,7-diphenyl-1,3-benzodioxole-5,6-dione have? |
| A: English synonyms of 4,7-diphenyl-1,3-benzodioxole-5,6-dione: phlebiarubrone, 4,7-diphenyl-benzo[1,3]dioxole-5,6-dione. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |