1-(3-Chloro-2-methylphenyl)-2-(2-methyl-2-propanyl)-3-(1,3-thiazo l-2-yl)guanidine structure
|
Common Name | 1-(3-Chloro-2-methylphenyl)-2-(2-methyl-2-propanyl)-3-(1,3-thiazo l-2-yl)guanidine | ||
|---|---|---|---|---|
| CAS Number | 72041-72-6 | Molecular Weight | 322.85600 | |
| Density | 1.23g/cm3 | Boiling Point | 420.2ºC at 760 mmHg | |
| Molecular Formula | C15H19ClN4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.9ºC | |
| Name | 1-(3-Chloro-2-methylphenyl)-2-(2-methyl-2-propanyl)-3-(1,3-thiazo l-2-yl)guanidine |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 420.2ºC at 760 mmHg |
| Molecular Formula | C15H19ClN4S |
| Molecular Weight | 322.85600 |
| Flash Point | 207.9ºC |
| Exact Mass | 322.10200 |
| PSA | 77.55000 |
| LogP | 5.05650 |
| Index of Refraction | 1.612 |
| InChIKey | KWRUXMOZYOKKBF-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)cccc1NC(=NC(C)(C)C)Nc1nccs1 |
|
~78%
1-(3-Chloro-2-m... CAS#:72041-72-6 |
| Literature: Rachlin, Schneur; Bramm, E.; Ahnfelt-Ronne, I.; Arrigoni-Martelli, E. Journal of Medicinal Chemistry, 1980 , vol. 23, # 1 p. 13 - 20 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |