Cyclodehydroisolubimin
Modify Date: 2025-09-09 20:38:48
Cyclodehydroisolubimin structure
|
Common Name | Cyclodehydroisolubimin | ||
|---|---|---|---|---|
| CAS Number | 72055-93-7 | Molecular Weight | 234.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cyclodehydroisolubimin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22O2 |
|---|---|
| Molecular Weight | 234.33 |
| InChIKey | YHIWYGHFGRMQMO-QHSBEEBCSA-N |
| SMILES | C=C(C)C1CCC2(C1)C1COC2(C)CC(=O)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Cyclodehydroisolubimin? |
| A: The English name of Cyclodehydroisolubimin is Cyclodehydroisolubimin. |
| Q: What is the InChIKey of Cyclodehydroisolubimin? |
| A: InChIKey of Cyclodehydroisolubimin is YHIWYGHFGRMQMO-QHSBEEBCSA-N. |
| Q: What is the molecular weight of Cyclodehydroisolubimin? |
| A: Molecular weight of Cyclodehydroisolubimin is 234.33. |
| Q: What is the CAS number of Cyclodehydroisolubimin? |
| A: CAS number of Cyclodehydroisolubimin is 72055-93-7. |
| Q: What is the Chinese name of 72055-93-7? |
| A: Chinese name of 72055-93-7 is 72055-93-7. |
| Q: What is the SMILES notation of Cyclodehydroisolubimin? |
| A: SMILES notation of Cyclodehydroisolubimin is C=C(C)C1CCC2(C1)C1COC2(C)CC(=O)C1. |
| Q: What is the molecular formula of Cyclodehydroisolubimin? |
| A: Molecular formula of Cyclodehydroisolubimin is C15H22O2. |