(4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate
Modify Date: 2026-09-28 18:17:42
(4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate structure
|
Common Name | (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate | ||
|---|---|---|---|---|
| CAS Number | 720697-98-3 | Molecular Weight | 478.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H43O6PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H43O6PS |
|---|---|
| Molecular Weight | 478.6 |
| InChIKey | OZYQMECHMOAFER-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC1COCCC1OP(O)(O)=S |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate? |
| A: SMILES notation of (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate is CCCCCCCCC=CCCCCCCCC(=O)OC1COCCC1OP(O)(O)=S. |
| Q: What is the molecular weight of (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate? |
| A: Molecular weight of (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate is 478.6. |
| Q: What is the CAS number of (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate? |
| A: CAS number of (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate is 720697-98-3. |
| Q: What is the molecular formula of (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate? |
| A: Molecular formula of (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate is C23H43O6PS. |
| Q: What is the English name of (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate? |
| A: The English name of (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate is (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate. |
| Q: What is the InChIKey of (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate? |
| A: InChIKey of (4-Dihydroxyphosphinothioyloxyoxan-3-yl) octadec-9-enoate is OZYQMECHMOAFER-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 720697-98-3? |
| A: Chinese name of 720697-98-3 is 720697-98-3. |