[2-methoxy-5-(trifluoromethyl)phenyl]-phenylmethanone structure
|
Common Name | [2-methoxy-5-(trifluoromethyl)phenyl]-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 72083-15-9 | Molecular Weight | 280.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-methoxy-5-(trifluoromethyl)phenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11F3O2 |
|---|---|
| Molecular Weight | 280.24200 |
| Exact Mass | 280.07100 |
| PSA | 26.30000 |
| LogP | 3.94500 |
| InChIKey | UVMOXAFMJPNMNM-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(F)(F)F)cc1C(=O)c1ccccc1 |
|
~99%
[2-methoxy-5-(t... CAS#:72083-15-9 |
| Literature: PHARMACIA and UPJOHN COMPANY Patent: WO2004/96751 A1, 2004 ; Location in patent: Page 11; 14-16 ; |
|
~56%
[2-methoxy-5-(t... CAS#:72083-15-9 |
| Literature: ELI LILLY AND COMPANY Patent: WO2005/19151 A1, 2005 ; Location in patent: Page/Page column 127 ; WO 2005/019151 A1 |
|
~%
[2-methoxy-5-(t... CAS#:72083-15-9 |
| Literature: Synthelabo Patent: DE2907379 , 1979 ; Chem.Abstr., 1980 , vol. 92, # 6279 |
| Methanone,[2-methoxy-5-(trifluoromethyl)phenyl]phenyl |
| (2-methoxy-5-trifluoromethyl-phenyl)-phenyl-methanone |