Benzenemethanol, a,3-bis(trifluoromethyl)-
Modify Date: 2025-08-25 17:54:37
Benzenemethanol, a,3-bis(trifluoromethyl)- structure
|
Common Name | Benzenemethanol, a,3-bis(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 721-36-8 | Molecular Weight | 244.13400 | |
| Density | 1.432g/cm3 | Boiling Point | 204.3ºC at 760 mmHg | |
| Molecular Formula | C9H6F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 77.4ºC | |
| Name | 2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 204.3ºC at 760 mmHg |
| Molecular Formula | C9H6F6O |
| Molecular Weight | 244.13400 |
| Flash Point | 77.4ºC |
| Exact Mass | 244.03200 |
| PSA | 20.23000 |
| LogP | 3.30110 |
| Index of Refraction | 1.416 |
| InChIKey | BSMNENKVFMPEGA-UHFFFAOYSA-N |
| SMILES | OC(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| HS Code | 2906299090 |
|---|
|
~95%
Benzenemethanol... CAS#:721-36-8 |
| Literature: Yu, Jin-Quan; Wu, Hai-Chen; Ramarao, Chandrashekar; Spencer, Jonathan B; Ley, Steven V Chemical communications (Cambridge, England), 2003 , # 6 p. 678 - 679 |
|
~%
Benzenemethanol... CAS#:721-36-8 |
| Literature: Ohno, Atsuyoshi; Yamamoto, Hiroyuki; Oka, Shinzaburo Journal of the American Chemical Society, 1981 , vol. 103, # 8 p. 2041 - 2045 |
![Ethanone,2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]- structure](https://image.chemsrc.com/caspic/199/721-37-9.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| dl-1-<m-Trifluormethyl-phenyl>-2,2,2-trifluor-ethanol |