(S)-chloro-(2,4-ditert-butylphenoxy)-phenylphosphane structure
|
Common Name | (S)-chloro-(2,4-ditert-butylphenoxy)-phenylphosphane | ||
|---|---|---|---|---|
| CAS Number | 72102-69-3 | Molecular Weight | 348.84700 | |
| Density | N/A | Boiling Point | 398.5ºC at 760 mmHg | |
| Molecular Formula | C20H26ClOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.8ºC | |
| Name | (S)-chloro-(2,4-ditert-butylphenoxy)-phenylphosphane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 398.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H26ClOP |
| Molecular Weight | 348.84700 |
| Flash Point | 194.8ºC |
| Exact Mass | 348.14100 |
| PSA | 22.82000 |
| LogP | 6.53660 |
| InChIKey | CDOULAJYDKNVEQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OP(Cl)c2ccccc2)c(C(C)(C)C)c1 |
|
~60%
(S)-chloro-(2,4... CAS#:72102-69-3 |
| Literature: Pastor, Stephen D.; Spivack, John D.; Steinhuebel, Leander P. Phosphorus and Sulfur and the Related Elements, 1985 , vol. 22, p. 169 - 176 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonochloridous acid,P-phenyl-,2,4-bis(1,1-dimethylethyl)phenyl ester |
| Phosphonochloridous acid,phenyl-,2,4-bis(1,1-dimethylethyl)phenyl ester |
| Chloro(2,4-di-tert-butylphenoxy)phenylphosphine |
| O-(2,4-di-tert-butylphenyl) phenylphosphonochloridite |
| (2,4-Di-tert-butylphenyl)phenylphosphonityl chloride |