5-Chlorosulfonyl-2,4-dimethoxybenzoic acid
Modify Date: 2025-08-27 18:14:51
5-Chlorosulfonyl-2,4-dimethoxybenzoic acid structure
|
Common Name | 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 72135-75-2 | Molecular Weight | 280.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9ClO6S |
|---|---|
| Molecular Weight | 280.68 |
| InChIKey | FDCPRDKOLWKALM-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(S(=O)(=O)Cl)cc1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid? |
| A: The English name of 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid is 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid. |
| Q: What is the molecular weight of 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid? |
| A: Molecular weight of 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid is 280.68. |
| Q: What is the CAS number of 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid? |
| A: CAS number of 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid is 72135-75-2. |
| Q: What is the SMILES notation of 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid? |
| A: SMILES notation of 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid is COc1cc(OC)c(S(=O)(=O)Cl)cc1C(=O)O. |
| Q: What is the molecular formula of 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid? |
| A: Molecular formula of 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid is C9H9ClO6S. |
| Q: What is the Chinese name of 72135-75-2? |
| A: Chinese name of 72135-75-2 is 72135-75-2. |
| Q: What is the InChIKey of 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid? |
| A: InChIKey of 5-Chlorosulfonyl-2,4-dimethoxybenzoic acid is FDCPRDKOLWKALM-UHFFFAOYSA-N. |