9H-Purin-6-amine, N-[(3-iodophenyl)methyl]- structure
|
Common Name | 9H-Purin-6-amine, N-[(3-iodophenyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 72158-53-3 | Molecular Weight | 351.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10IN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9H-Purin-6-amine, N-[(3-iodophenyl)methyl] |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10IN5 |
|---|---|
| Molecular Weight | 351.14600 |
| Exact Mass | 350.99800 |
| PSA | 66.49000 |
| LogP | 2.64260 |
| InChIKey | WHYVKEGFJPLEJZ-UHFFFAOYSA-N |
| SMILES | Ic1cccc(CNc2ncnc3nc[nH]c23)c1 |
|
~86%
9H-Purin-6-amin... CAS#:72158-53-3 |
| Literature: Jacobson, Kenneth A.; Siddiqi, Suhaib M.; Olah, Mark E.; Ji, Xiao-duo; Melman, Neli; et al. Journal of Medicinal Chemistry, 1995 , vol. 38, # 10 p. 1720 - 1735 |
|
~%
9H-Purin-6-amin... CAS#:72158-53-3 |
| Literature: Dolezal, Karel; Popa, Igor; Krystof, Vladimir; Spichal, Lukas; Fojtikova, Martina; Holub, Jan; Lenobel, Rene; Schmuelling, Thomas; Strnad, Miroslav Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 3 p. 875 - 884 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N6-(3-iodobenzyl)adenine |
| 3-(3-Dimethylpropylamino)indol |
| N-Dimethylhomotryptamine |
| N-Dimethylhomotryptamin |
| (3-indol-3-yl-propyl)-dimethyl-amine |
| (3-iodo-benzyl)-(7(9)H-purin-6-yl)-amine |
| m-Iod-6-benzylaminopurin |