(2S,4R)-1-BENZYL-2-METHYL-4-FLUOROPYRROLIDINE-1,2-DICARBOXYLATE structure
|
Common Name | (2S,4R)-1-BENZYL-2-METHYL-4-FLUOROPYRROLIDINE-1,2-DICARBOXYLATE | ||
|---|---|---|---|---|
| CAS Number | 72180-24-6 | Molecular Weight | 281.28000 | |
| Density | 1.267 g/cm3 | Boiling Point | 382.901ºC at 760 mmHg | |
| Molecular Formula | C14H16FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.372ºC | |
| Name | 1-O-benzyl 2-O-methyl (2S,4R)-4-fluoropyrrolidine-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267 g/cm3 |
|---|---|
| Boiling Point | 382.901ºC at 760 mmHg |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28000 |
| Flash Point | 185.372ºC |
| Exact Mass | 281.10600 |
| PSA | 55.84000 |
| LogP | 1.84650 |
| Index of Refraction | 1.564 |
| InChIKey | FDPGMTFRBRCTSR-NEPJUHHUSA-N |
| SMILES | COC(=O)C1CC(F)CN1C(=O)OCc1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~32%
(2S,4R)-1-BENZY... CAS#:72180-24-6 |
| Literature: Smith, Elisabeth M.; Swiss, Gerald F.; Neustadt, Bernard R.; Gold, Elijah H.; Sommer, Jane A.; et al. Journal of Medicinal Chemistry, 1988 , vol. 31, # 4 p. 875 - 885 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-[(phenylmethoxy)carbonyl]-4(R)-fluoro-(S)-proline methyl ester |
| 1-benzyl 2-methyl (2S,4R)-4-fluoropyrrolidine-1,2-dicarboxylate |
| (2S,4R)-1-(benzyloxycarbonyl)-4-fluoro-2-methylpyrrolidine-2-carboxylic acid |
| (2S,4R)-1-benzyl-2-methyl-4-fluoropyrrolidine-1,2-dicarboxylate |
| A9407 |