3'-Methylazobenzene-4-amine structure
|
Common Name | 3'-Methylazobenzene-4-amine | ||
|---|---|---|---|---|
| CAS Number | 722-23-6 | Molecular Weight | 211.26200 | |
| Density | 1.11g/cm3 | Boiling Point | 388.4ºC at 760 mmHg | |
| Molecular Formula | C13H13N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.7ºC | |
| Name | 4-[(3-methylphenyl)diazenyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 388.4ºC at 760 mmHg |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.26200 |
| Flash Point | 188.7ºC |
| Exact Mass | 211.11100 |
| PSA | 50.74000 |
| LogP | 4.57380 |
| Index of Refraction | 1.601 |
| InChIKey | KCOITMFSLVDOGO-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N=Nc2ccc(N)cc2)c1 |
|
~%
3'-Methylazoben... CAS#:722-23-6 |
| Literature: Burkhard; Moore Journal of the American Chemical Society, 1955 , vol. 77, p. 6057 |
|
~%
3'-Methylazoben... CAS#:722-23-6 |
| Literature: Sharma, Manisha; Maheshwari, Arti; Bindal, Nitin Journal of Heterocyclic Chemistry, 2013 , vol. 50, # SUPPL.1 p. E116-E120 |
|
~%
3'-Methylazoben... CAS#:722-23-6 |
| Literature: v.Mechel; Stauffer Helvetica Chimica Acta, 1941 , vol. 24, p. 151 E,152 E,153 E |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4'-Amino-3-methyl-azobenzol |
| ANILINE,p-(3-METHYLPHENYLAZO) |
| 3'-Methyl-4-aminoazobenzene |
| 4-m-tolylazo-aniline |
| 3'-Methyl-4-amino-azobenzol |
| 4-((3-Methylphenyl)azo)benzenamine |
| 4-[(E)-(3-methylphenyl)diazenyl]aniline |