4-[[2,4-dihydroxy-3,5-bis(xylylazo)phenyl]azo]benzenesulphonic acid, compound with N,N'-di-(o-tolyl)guanidine (1:1) structure
|
Common Name | 4-[[2,4-dihydroxy-3,5-bis(xylylazo)phenyl]azo]benzenesulphonic acid, compound with N,N'-di-(o-tolyl)guanidine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 72208-14-1 | Molecular Weight | 797.92400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H43N9O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-bis(2-methylphenyl)guanidine,4-[(2E)-2-[(5E)-3-[(2,4-dimethylphenyl)diazenyl]-5-[(2,4-dimethylphenyl)hydrazinylidene]-4,6-dioxocyclohex-2-en-1-ylidene]hydrazinyl]benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C43H43N9O5S |
|---|---|
| Molecular Weight | 797.92400 |
| Exact Mass | 797.31100 |
| PSA | 218.30000 |
| LogP | 10.45720 |
| InChIKey | QKWNQRIXAHIZQB-XMZXBYAXSA-N |
| SMILES | Cc1ccc(N=Nc2cc(=NNc3ccc(S(=O)(=O)O)cc3)c(=O)c(=NNc3ccc(C)cc3C)c2=O)c(C)c1.Cc1ccccc1N=C(N)Nc1ccccc1C |
| EINECS 276-467-1 |
| 4-((2,4-Dihydroxy-3,5-bis(xylylazo)phenyl)azo)benzenesulphonic acid,compound with N,N'-di-(o-tolyl)guanidine (1:1) |