7-Amino-4-hydroxy-3-[[2-methoxy-4-[(3-sulfophenyl)azo]phenyl]azo]-2-naphthalenesulfonic acid, compd. with 2,2',2''-nitriloethanol(1:2) structure
|
Common Name | 7-Amino-4-hydroxy-3-[[2-methoxy-4-[(3-sulfophenyl)azo]phenyl]azo]-2-naphthalenesulfonic acid, compd. with 2,2',2''-nitriloethanol(1:2) | ||
|---|---|---|---|---|
| CAS Number | 72208-31-2 | Molecular Weight | 855.93200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H49N7O14S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3E)-7-amino-3-[[2-methoxy-4-[(3-sulfophenyl)diazenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid,2-[bis(2-hydroxyethyl)amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C35H49N7O14S2 |
|---|---|
| Molecular Weight | 855.93200 |
| Exact Mass | 855.27800 |
| PSA | 354.79000 |
| LogP | 3.17900 |
| InChIKey | RNXYOGUSGIPWGG-UHFFFAOYSA-N |
| SMILES | COc1cc(N=Nc2cccc(S(=O)(=O)O)c2)ccc1N=Nc1c(S(=O)(=O)O)cc2cc(N)ccc2c1O.OCCN(CCO)CCO.OCCN(CCO)CCO |
| 7-Amino-4-hydroxy-3-((2-methoxy-4-((m-sulfophenyl)azo)phenyl)azo)-2-naphthalenesulfonic acid,compd. with 2,2',2''-nitrilotriethanol (1:2) |
| 2-Naphthalenesulfonic acid,7-amino-4-hydroxy-3-((2-methoxy-4-((3-sulfophenyl)azo)phenyl)azo)-,compd. with 2,2',2''-nitrilotris(ethanol) (1:2) |
| 2-Naphthalenesulfonic acid,7-amino-4-hydroxy-3-(2-(2-methoxy-4-(2-(3-sulfophenyl)diazenyl)phenyl)diazenyl)-,compd. with 2,2',2''-nitrilotris(ethanol) (1:2) |