2-(2-hydroxy-3-prop-2-enylphenyl)-6-prop-2-enylphenol structure
|
Common Name | 2-(2-hydroxy-3-prop-2-enylphenyl)-6-prop-2-enylphenol | ||
|---|---|---|---|---|
| CAS Number | 72216-56-9 | Molecular Weight | 266.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-hydroxy-3-prop-2-enylphenyl)-6-prop-2-enylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H18O2 |
|---|---|
| Molecular Weight | 266.33400 |
| Exact Mass | 266.13100 |
| PSA | 40.46000 |
| LogP | 4.22180 |
| InChIKey | OUQOELSQUKETGS-UHFFFAOYSA-N |
| SMILES | C=CCc1cccc(-c2cccc(CC=C)c2O)c1O |
|
~99%
2-(2-hydroxy-3-... CAS#:72216-56-9 |
| Literature: Reinhoudt, D. N.; Jong, F. de; Vondervoort, E. M. van Tetrahedron, 1981 , vol. 37, p. 1753 - 1762 |
|
~%
2-(2-hydroxy-3-... CAS#:72216-56-9 |
| Literature: Amblard, Franck; Govindarajan, Baskaran; Lefkove, Benjamin; Rapp, Kimberly L.; Detorio, Mervi; Arbiser, Jack L.; Schinazi, Raymond F. Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 16 p. 4428 - 4431 |
|
~%
2-(2-hydroxy-3-... CAS#:72216-56-9 |
| Literature: Pearson,D.P.J. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1979 , p. 3113 - 3126 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| dihydroxy-2,2' diallyl-3,3' biphenyle |
| 2,2'-Dihydroxy-3,3'-diallylbiphenyl |
| [1,1'-Biphenyl]-2,2'-diol,3,3'-di-2-propenyl |
| 3,3'-diallylbiphenyl-2,2'-diol |
| 3,3'-diallyl-2,2'-dihydroxy-1,1'biphenyl |