5-isobutylnaphthalene-1-acetic acid structure
|
Common Name | 5-isobutylnaphthalene-1-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 72221-66-0 | Molecular Weight | 242.31300 | |
| Density | 1.115g/cm3 | Boiling Point | 410.2ºC at 760 mmHg | |
| Molecular Formula | C16H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307ºC | |
| Name | 2-[5-(2-methylpropyl)naphthalen-1-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 410.2ºC at 760 mmHg |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.31300 |
| Flash Point | 307ºC |
| Exact Mass | 242.13100 |
| PSA | 37.30000 |
| LogP | 3.66540 |
| Index of Refraction | 1.596 |
| InChIKey | MJPDFVFWDUWGPQ-UHFFFAOYSA-N |
| SMILES | CC(C)Cc1cccc2c(CC(=O)O)cccc12 |
|
~%
5-isobutylnapht... CAS#:72221-66-0 |
| Literature: Saint-Martino-Descours; Cottin; Pacheco European Journal of Medicinal Chemistry, 1979 , vol. 14, # 5 p. 455 - 462 |
|
~%
5-isobutylnapht... CAS#:72221-66-0 |
| Literature: Saint-Martino-Descours; Cottin; Pacheco European Journal of Medicinal Chemistry, 1979 , vol. 14, # 5 p. 455 - 462 |
|
~%
5-isobutylnapht... CAS#:72221-66-0 |
| Literature: Saint-Martino-Descours; Cottin; Pacheco European Journal of Medicinal Chemistry, 1979 , vol. 14, # 5 p. 455 - 462 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Isobutylnaphthalene-1-acetic acid |
| [5-isobutyl-1-naphthyl]acetic acid |
| Acide isobutyl-5 naphthyl-1 acetique [French] |
| (5-Isobutyl-1-naphthyl)essigsaeure |
| 1-Naphthaleneacetic acid,5-(2-methylpropyl) |
| 5-(2-Methylpropyl)-1-naphthaleneacetic acid |
| 5-Isobutyl-1-naphthaleneacetic acid |