2-(1,2-dimethylindol-3-yl)propanoic acid structure
|
Common Name | 2-(1,2-dimethylindol-3-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 72228-43-4 | Molecular Weight | 217.26400 | |
| Density | 1.15g/cm3 | Boiling Point | 399.4ºC at 760 mmHg | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.3ºC | |
| Name | 2-(1,2-dimethylindol-3-yl)propanoic acid |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 399.4ºC at 760 mmHg |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26400 |
| Flash Point | 195.3ºC |
| Exact Mass | 217.11000 |
| PSA | 42.23000 |
| LogP | 2.67480 |
| Index of Refraction | 1.58 |
| InChIKey | HJMMPTYUZJVSMF-UHFFFAOYSA-N |
| SMILES | Cc1c(C(C)C(=O)O)c2ccccc2n1C |
|
~73%
2-(1,2-dimethyl... CAS#:72228-43-4 |
| Literature: Adam, Waldemar; Takayama, Kiyoshige Journal of Organic Chemistry, 1980 , vol. 45, # 3 p. 447 - 452 |
|
~%
2-(1,2-dimethyl... CAS#:72228-43-4 |
| Literature: Adam, Waldemar; Takayama, Kiyoshige Journal of Organic Chemistry, 1980 , vol. 45, # 3 p. 447 - 452 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |