ethane-1,2-diol,2-ethyl-2-(hydroxymethyl)propane-1,3-diol,1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene structure
|
Common Name | ethane-1,2-diol,2-ethyl-2-(hydroxymethyl)propane-1,3-diol,1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 72231-00-6 | Molecular Weight | 446.49400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H30N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethane-1,2-diol,2-ethyl-2-(hydroxymethyl)propane-1,3-diol,1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H30N2O7 |
|---|---|
| Molecular Weight | 446.49400 |
| Exact Mass | 446.20500 |
| PSA | 160.01000 |
| LogP | 1.54270 |
| InChIKey | RKZRYHWGCABWKL-UHFFFAOYSA-N |
| SMILES | CCC(CO)(CO)CO.O=C=Nc1ccc(Cc2ccc(N=C=O)cc2)cc1.OCCO |
| 4,4'-Diphenylmethane diisocyanate,ethylene glycol,trimethylolpropane polymer |
| 1,3-Propanediol,2-ethyl-2-(hydroxymethyl)-,polymer with 1,2-ethanediol and 1,1'-methylenebis(4-isocyanatobenzene) |